C27H34O2Si — CID 10574069
(1R,3R,4S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-3-methyltricyclo[5.2.1.04,10]decan-2-one (PubChem CID 10574069) has the molecular formula C27H34O2Si and a molecular weight of 418.65 g/mol. Its IUPAC name is (1R,3R,4S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-3-methyltricyclo[5.2.1.04,10]decan-2-one.
| Compound Name | (1R,3R,4S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-3-methyltricyclo[5.2.1.04,10]decan-2-one |
|---|---|
| PubChem CID | 10574069 |
| Molecular Formula | C27H34O2Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (1R,3R,4S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-3-methyltricyclo[5.2.1.04,10]decan-2-one |
| SMILES | C[C@H]1C(=O)[C@@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]3CC[C@H]1[C@@H]32 |
| InChI | InChI=1S/C27H34O2Si/c1-18-21-15-16-22-24(17-23(25(21)22)26(18)28)29-30(27(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18,21-25H,15-17H2,1-4H3/t18-,21-,22+,23-,24+,25+/m1/s1 |
| InChIKey | VKWYHZRULSDXNJ-MMNWGEBOSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|