C27H34O5Si — CID 148550426
methyl (4aS,7S,7aS)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 148550426) has the molecular formula C27H34O5Si and a molecular weight of 466.65 g/mol. Its IUPAC name is methyl (4aS,7S,7aS)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (4aS,7S,7aS)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 148550426 |
| Molecular Formula | C27H34O5Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | methyl (4aS,7S,7aS)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=COC(O)[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C27H34O5Si/c1-27(2,3)33(20-11-7-5-8-12-20,21-13-9-6-10-14-21)32-17-19-15-16-22-23(25(28)30-4)18-31-26(29)24(19)22/h5-14,18-19,22,24,26,29H,15-17H2,1-4H3/t19-,22-,24-,26?/m1/s1 |
| InChIKey | ZXOBWJKGKQPWAE-BJIJIXPDSA-N |
| XLogP | 3.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|