C24H30N2O3Si — CID 101209477
methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-cyanopiperidine-1-carboxylate (PubChem CID 101209477) has the molecular formula C24H30N2O3Si and a molecular weight of 422.60 g/mol. Its IUPAC name is methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-cyanopiperidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-cyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 101209477 |
| Molecular Formula | C24H30N2O3Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-cyanopiperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1C#N |
| InChI | InChI=1S/C24H30N2O3Si/c1-24(2,3)30(21-11-7-5-8-12-21,22-13-9-6-10-14-22)29-20-15-16-26(23(27)28-4)19(17-20)18-25/h5-14,19-20H,15-17H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | HNQGYYHKVDWNLF-VQTJNVASSA-N |
| XLogP | 3.69 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|