C9H14N2O2 — CID 25198036
methyl (2S,4R)-2-cyano-4-methylpiperidine-1-carboxylate (PubChem CID 25198036) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is methyl (2S,4R)-2-cyano-4-methylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-2-cyano-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 25198036 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | methyl (2S,4R)-2-cyano-4-methylpiperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](C)C[C@H]1C#N |
| InChI | InChI=1S/C9H14N2O2/c1-7-3-4-11(9(12)13-2)8(5-7)6-10/h7-8H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | NEEFUEXGHLTNSZ-SFYZADRCSA-N |
| XLogP | 1.38 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |