methyl 2-cyanopiperazine-1-carboxylate

C7H11N3O2 — CID 79091281

IUPACmethyl 2-cyanopiperazine-1-carboxylate
SMILESCOC(=O)N1CCNCC1C#N
InChIInChI=1S/C7H11N3O2/c1-12-7(11)10-3-2-9-5-6(10)4-8/h6,9H,2-3,5H2,1H3
InChIKeyHWUAFVLGBKGYNI-UHFFFAOYSA-N
MW169.18 g/mol
LogP-0.45
Rot. Bonds

About methyl 2-cyanopiperazine-1-carboxylate

methyl 2-cyanopiperazine-1-carboxylate (PubChem CID 79091281) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 2-cyanopiperazine-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-cyanopiperazine-1-carboxylate
PubChem CID79091281
Molecular FormulaC7H11N3O2
Molecular Weight169.18 g/mol
Exact Mass169.09
IUPAC Namemethyl 2-cyanopiperazine-1-carboxylate
SMILESCOC(=O)N1CCNCC1C#N
InChIInChI=1S/C7H11N3O2/c1-12-7(11)10-3-2-9-5-6(10)4-8/h6,9H,2-3,5H2,1H3
InChIKeyHWUAFVLGBKGYNI-UHFFFAOYSA-N
XLogP-0.45
TPSA65.36 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 5-0.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-cyanopiperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyanopiperazine-1-carboxylate?
The IUPAC name of methyl 2-cyanopiperazine-1-carboxylate (CID 79091281) is methyl 2-cyanopiperazine-1-carboxylate.
What is the SMILES notation for methyl 2-cyanopiperazine-1-carboxylate?
The canonical SMILES for methyl 2-cyanopiperazine-1-carboxylate is COC(=O)N1CCNCC1C#N.
What is the InChIKey of methyl 2-cyanopiperazine-1-carboxylate?
The InChIKey is HWUAFVLGBKGYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-12-7(11)10-3-2-9-5-6(10)4-8/h6,9H,2-3,5H2,1H3.
What are the key properties of methyl 2-cyanopiperazine-1-carboxylate?
methyl 2-cyanopiperazine-1-carboxylate has a molecular weight of 169.18 g/mol, XLogP of -0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyanopiperazine-1-carboxylate is sourced from PubChem (CID 79091281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).