C12H14N4O2 — CID 79086365
1-(2-methoxypyridine-3-carbonyl)piperazine-2-carbonitrile (PubChem CID 79086365) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(2-methoxypyridine-3-carbonyl)piperazine-2-carbonitrile.
| Compound Name | 1-(2-methoxypyridine-3-carbonyl)piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 79086365 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-(2-methoxypyridine-3-carbonyl)piperazine-2-carbonitrile |
| SMILES | COc1ncccc1C(=O)N1CCNCC1C#N |
| InChI | InChI=1S/C12H14N4O2/c1-18-11-10(3-2-4-15-11)12(17)16-6-5-14-8-9(16)7-13/h2-4,9,14H,5-6,8H2,1H3 |
| InChIKey | FBOGTFQKCMLTLY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |