methyl 2,4-dimethylpiperidine-1-carboxylate

C9H17NO2 — CID 115643665

IUPACmethyl 2,4-dimethylpiperidine-1-carboxylate
SMILESCOC(=O)N1CCC(C)CC1C
InChIInChI=1S/C9H17NO2/c1-7-4-5-10(8(2)6-7)9(11)12-3/h7-8H,4-6H2,1-3H3
InChIKeyMGVABTMLUQIEOV-UHFFFAOYSA-N
MW171.24 g/mol
LogP1.87
Rot. Bonds

About methyl 2,4-dimethylpiperidine-1-carboxylate

methyl 2,4-dimethylpiperidine-1-carboxylate (PubChem CID 115643665) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is methyl 2,4-dimethylpiperidine-1-carboxylate.

Molecular Properties

Compound Namemethyl 2,4-dimethylpiperidine-1-carboxylate
PubChem CID115643665
Molecular FormulaC9H17NO2
Molecular Weight171.24 g/mol
Exact Mass171.13
IUPAC Namemethyl 2,4-dimethylpiperidine-1-carboxylate
SMILESCOC(=O)N1CCC(C)CC1C
InChIInChI=1S/C9H17NO2/c1-7-4-5-10(8(2)6-7)9(11)12-3/h7-8H,4-6H2,1-3H3
InChIKeyMGVABTMLUQIEOV-UHFFFAOYSA-N
XLogP1.87
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.24
LogP ≤ 51.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2,4-dimethylpiperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dimethylpiperidine-1-carboxylate?
The IUPAC name of methyl 2,4-dimethylpiperidine-1-carboxylate (CID 115643665) is methyl 2,4-dimethylpiperidine-1-carboxylate.
What is the SMILES notation for methyl 2,4-dimethylpiperidine-1-carboxylate?
The canonical SMILES for methyl 2,4-dimethylpiperidine-1-carboxylate is COC(=O)N1CCC(C)CC1C.
What is the InChIKey of methyl 2,4-dimethylpiperidine-1-carboxylate?
The InChIKey is MGVABTMLUQIEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-7-4-5-10(8(2)6-7)9(11)12-3/h7-8H,4-6H2,1-3H3.
What are the key properties of methyl 2,4-dimethylpiperidine-1-carboxylate?
methyl 2,4-dimethylpiperidine-1-carboxylate has a molecular weight of 171.24 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethylpiperidine-1-carboxylate is sourced from PubChem (CID 115643665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).