C9H17NO2 — CID 145048176
methyl (2S,4R)-2,4-dimethylpiperidine-1-carboxylate (PubChem CID 145048176) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is methyl (2S,4R)-2,4-dimethylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-2,4-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 145048176 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | methyl (2S,4R)-2,4-dimethylpiperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](C)C[C@@H]1C |
| InChI | InChI=1S/C9H17NO2/c1-7-4-5-10(8(2)6-7)9(11)12-3/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | MGVABTMLUQIEOV-SFYZADRCSA-N |
| XLogP | 1.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |