C12H23NO2 — CID 79199279
1-(2,4-dimethylpiperidin-1-yl)-5-hydroxypentan-1-one (PubChem CID 79199279) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(2,4-dimethylpiperidin-1-yl)-5-hydroxypentan-1-one.
| Compound Name | 1-(2,4-dimethylpiperidin-1-yl)-5-hydroxypentan-1-one |
|---|---|
| PubChem CID | 79199279 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-(2,4-dimethylpiperidin-1-yl)-5-hydroxypentan-1-one |
| SMILES | CC1CCN(C(=O)CCCCO)C(C)C1 |
| InChI | InChI=1S/C12H23NO2/c1-10-6-7-13(11(2)9-10)12(15)5-3-4-8-14/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | KJHFCASLUFOFSW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|