methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate

C8H10N2O3 — CID 83846711

IUPACmethyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate
SMILESCOC(=O)N1CC(=O)C(C#N)C1C
InChIInChI=1S/C8H10N2O3/c1-5-6(3-9)7(11)4-10(5)8(12)13-2/h5-6H,4H2,1-2H3
InChIKeyXYDQOWGTDOGMLA-UHFFFAOYSA-N
MW182.18 g/mol
LogP0.17
Rot. Bonds

About methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate

methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate (PubChem CID 83846711) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate
PubChem CID83846711
Molecular FormulaC8H10N2O3
Molecular Weight182.18 g/mol
Exact Mass182.07
IUPAC Namemethyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate
SMILESCOC(=O)N1CC(=O)C(C#N)C1C
InChIInChI=1S/C8H10N2O3/c1-5-6(3-9)7(11)4-10(5)8(12)13-2/h5-6H,4H2,1-2H3
InChIKeyXYDQOWGTDOGMLA-UHFFFAOYSA-N
XLogP0.17
TPSA70.40 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 50.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate?
The IUPAC name of methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate (CID 83846711) is methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate?
The canonical SMILES for methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate is COC(=O)N1CC(=O)C(C#N)C1C.
What is the InChIKey of methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate?
The InChIKey is XYDQOWGTDOGMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-5-6(3-9)7(11)4-10(5)8(12)13-2/h5-6H,4H2,1-2H3.
What are the key properties of methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate?
methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate has a molecular weight of 182.18 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-2-methyl-4-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 83846711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).