C12H16N2O4 — CID 176644891
tert-butyl (2S)-3-cyano-2-methyl-4,5-dioxopiperidine-1-carboxylate (PubChem CID 176644891) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is tert-butyl (2S)-3-cyano-2-methyl-4,5-dioxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-3-cyano-2-methyl-4,5-dioxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 176644891 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | tert-butyl (2S)-3-cyano-2-methyl-4,5-dioxopiperidine-1-carboxylate |
| SMILES | C[C@H]1C(C#N)C(=O)C(=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H16N2O4/c1-7-8(5-13)10(16)9(15)6-14(7)11(17)18-12(2,3)4/h7-8H,6H2,1-4H3/t7-,8?/m0/s1 |
| InChIKey | IYECQGARDTZQTK-JAMMHHFISA-N |
| XLogP | 0.90 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|