C17H30N2O4 — CID 15357285
ditert-butyl (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-1,3-dicarboxylate (PubChem CID 15357285) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is ditert-butyl (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-1,3-dicarboxylate.
| Compound Name | ditert-butyl (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15357285 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | ditert-butyl (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CN(C(=O)OC(C)(C)C)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H30N2O4/c1-16(2,3)22-14(20)18-11-19(15(21)23-17(4,5)6)13-10-8-7-9-12(13)18/h12-13H,7-11H2,1-6H3/t12-,13-/m1/s1 |
| InChIKey | ZKDQRZKUWOPNGD-CHWSQXEVSA-N |
| XLogP | 3.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |