C18H32N2O4 — CID 69231191
ditert-butyl 7,9-diazabicyclo[4.2.2]decane-7,9-dicarboxylate (PubChem CID 69231191) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is ditert-butyl 7,9-diazabicyclo[4.2.2]decane-7,9-dicarboxylate.
| Compound Name | ditert-butyl 7,9-diazabicyclo[4.2.2]decane-7,9-dicarboxylate |
|---|---|
| PubChem CID | 69231191 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | ditert-butyl 7,9-diazabicyclo[4.2.2]decane-7,9-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCCCC1CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O4/c1-17(2,3)23-15(21)19-11-14-10-8-7-9-13(19)12-20(14)16(22)24-18(4,5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | WKRRGBLYFWOXRT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |