C13H24N2O2 — CID 75360755
tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate (PubChem CID 75360755) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate.
| Compound Name | tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate |
|---|---|
| PubChem CID | 75360755 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCC[C@@H]1CNC2 |
| InChI | InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15-9-10-5-4-6-11(15)8-14-7-10/h10-11,14H,4-9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | SEBKQWOUTPGSCS-GHMZBOCLSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |