C15H27N3O4 — CID 168886053
ditert-butyl 3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate (PubChem CID 168886053) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is ditert-butyl 3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate.
| Compound Name | ditert-butyl 3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 168886053 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ditert-butyl 3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CNCC(C2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O4/c1-14(2,3)21-12(19)17-10-7-11(9-16-8-10)18(17)13(20)22-15(4,5)6/h10-11,16H,7-9H2,1-6H3 |
| InChIKey | QEWUKJSCPUYFBL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |