C16H30N2O4 — CID 101100448
ditert-butyl (3S,6R)-3,6-dimethyldiazinane-1,2-dicarboxylate (PubChem CID 101100448) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is ditert-butyl (3S,6R)-3,6-dimethyldiazinane-1,2-dicarboxylate.
| Compound Name | ditert-butyl (3S,6R)-3,6-dimethyldiazinane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101100448 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ditert-butyl (3S,6R)-3,6-dimethyldiazinane-1,2-dicarboxylate |
| SMILES | C[C@@H]1CC[C@H](C)N(C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-11-9-10-12(2)18(14(20)22-16(6,7)8)17(11)13(19)21-15(3,4)5/h11-12H,9-10H2,1-8H3/t11-,12+ |
| InChIKey | BJHRDMPIGHCJQG-TXEJJXNPSA-N |
| XLogP | 3.95 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |