C13H24N2O4 — CID 102456456
ditert-butyl 3-methyldiazetidine-1,2-dicarboxylate (PubChem CID 102456456) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is ditert-butyl 3-methyldiazetidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 3-methyldiazetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102456456 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | ditert-butyl 3-methyldiazetidine-1,2-dicarboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-9-8-14(10(16)18-12(2,3)4)15(9)11(17)19-13(5,6)7/h9H,8H2,1-7H3 |
| InChIKey | QQMXRGREBTXXQK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |