About tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate
tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 90955389) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate.
Analyze tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate?
The IUPAC name of tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate (CID 90955389) is tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate.
What is the SMILES notation for tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate?
The canonical SMILES for tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate is CC1CN(C(=O)OC(C)(C)C)C=C1N.
What is the InChIKey of tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate?
The InChIKey is UNKAAACBIWKWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-7-5-12(6-8(7)11)9(13)14-10(2,3)4/h6-7H,5,11H2,1-4H3.
What are the key properties of tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate?
tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate has a molecular weight of 198.27 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-amino-3-methyl-2,3-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 90955389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).