C9H16N2O2 — CID 155896869
tert-butyl 3-amino-2,3-dihydropyrrole-1-carboxylate (PubChem CID 155896869) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is tert-butyl 3-amino-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-amino-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 155896869 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | tert-butyl 3-amino-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(N)C1 |
| InChI | InChI=1S/C9H16N2O2/c1-9(2,3)13-8(12)11-5-4-7(10)6-11/h4-5,7H,6,10H2,1-3H3 |
| InChIKey | MSTTULLGZLZBHU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |