C10H18N4O2 — CID 141134510
tert-butyl 2,3,8,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate (PubChem CID 141134510) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl 2,3,8,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 2,3,8,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 141134510 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | tert-butyl 2,3,8,8a-tetrahydro-1H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CN2CNNC2C1 |
| InChI | InChI=1S/C10H18N4O2/c1-10(2,3)16-9(15)13-4-5-14-7-11-12-8(14)6-13/h4-5,8,11-12H,6-7H2,1-3H3 |
| InChIKey | PNEZRXOPESNYPN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |