C15H18ClNO2 — CID 101053309
tert-butyl 3-(4-chlorophenyl)-2,3-dihydropyrrole-1-carboxylate (PubChem CID 101053309) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is tert-butyl 3-(4-chlorophenyl)-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-(4-chlorophenyl)-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101053309 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | tert-butyl 3-(4-chlorophenyl)-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H18ClNO2/c1-15(2,3)19-14(18)17-9-8-12(10-17)11-4-6-13(16)7-5-11/h4-9,12H,10H2,1-3H3 |
| InChIKey | XFHCBAZYPDEUNI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |