C15H20ClNO3 — CID 126652464
tert-butyl 2-[(4-chlorophenyl)methyl]-3-hydroxyazetidine-1-carboxylate (PubChem CID 126652464) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is tert-butyl 2-[(4-chlorophenyl)methyl]-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-chlorophenyl)methyl]-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 126652464 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | tert-butyl 2-[(4-chlorophenyl)methyl]-3-hydroxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)C1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO3/c1-15(2,3)20-14(19)17-9-13(18)12(17)8-10-4-6-11(16)7-5-10/h4-7,12-13,18H,8-9H2,1-3H3 |
| InChIKey | WGEBXWYNQGDLOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |