C18H26ClNO3 — CID 155765912
tert-butyl (2S)-2-[(4-chlorophenyl)methyl]-4-hydroxy-4-methylpiperidine-1-carboxylate (PubChem CID 155765912) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-chlorophenyl)methyl]-4-hydroxy-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4-chlorophenyl)methyl]-4-hydroxy-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155765912 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl (2S)-2-[(4-chlorophenyl)methyl]-4-hydroxy-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(O)CCN(C(=O)OC(C)(C)C)[C@@H](Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H26ClNO3/c1-17(2,3)23-16(21)20-10-9-18(4,22)12-15(20)11-13-5-7-14(19)8-6-13/h5-8,15,22H,9-12H2,1-4H3/t15-,18?/m0/s1 |
| InChIKey | DTVRZZKRNNNYDI-BUSXIPJBSA-N |
| XLogP | 4.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |