C18H24ClNO4 — CID 155576982
tert-butyl (2R)-2-acetyl-5-[(4-chlorophenyl)methyl]morpholine-4-carboxylate (PubChem CID 155576982) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is tert-butyl (2R)-2-acetyl-5-[(4-chlorophenyl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-acetyl-5-[(4-chlorophenyl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 155576982 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | tert-butyl (2R)-2-acetyl-5-[(4-chlorophenyl)methyl]morpholine-4-carboxylate |
| SMILES | CC(=O)[C@H]1CN(C(=O)OC(C)(C)C)C(Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C18H24ClNO4/c1-12(21)16-10-20(17(22)24-18(2,3)4)15(11-23-16)9-13-5-7-14(19)8-6-13/h5-8,15-16H,9-11H2,1-4H3/t15?,16-/m1/s1 |
| InChIKey | ZVWCSURNQOONFH-OEMAIJDKSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |