C20H26ClN3O3 — CID 155577150
tert-butyl 5-[(4-chlorophenyl)methyl]-2-(2-methylpyrazol-3-yl)morpholine-4-carboxylate (PubChem CID 155577150) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is tert-butyl 5-[(4-chlorophenyl)methyl]-2-(2-methylpyrazol-3-yl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 5-[(4-chlorophenyl)methyl]-2-(2-methylpyrazol-3-yl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 155577150 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl 5-[(4-chlorophenyl)methyl]-2-(2-methylpyrazol-3-yl)morpholine-4-carboxylate |
| SMILES | Cn1nccc1C1CN(C(=O)OC(C)(C)C)C(Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-20(2,3)27-19(25)24-12-18(17-9-10-22-23(17)4)26-13-16(24)11-14-5-7-15(21)8-6-14/h5-10,16,18H,11-13H2,1-4H3 |
| InChIKey | IQSNSEAGVNXHJA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |