C18H26ClN3O2 — CID 67497681
tert-butyl 7-[[(5-chloro-2-pyridinyl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 67497681) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is tert-butyl 7-[[(5-chloro-2-pyridinyl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl 7-[[(5-chloro-2-pyridinyl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 67497681 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 7-[[(5-chloro-2-pyridinyl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC2)CC1CNc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H26ClN3O2/c1-17(2,3)24-16(23)22-9-8-18(6-7-18)10-14(22)12-21-15-5-4-13(19)11-20-15/h4-5,11,14H,6-10,12H2,1-3H3,(H,20,21) |
| InChIKey | GBNCDEWIMCEGOP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |