C17H25FN4O2 — CID 67498621
tert-butyl 7-[[(5-fluoropyrimidin-2-yl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 67498621) has the molecular formula C17H25FN4O2 and a molecular weight of 336.41 g/mol. Its IUPAC name is tert-butyl 7-[[(5-fluoropyrimidin-2-yl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl 7-[[(5-fluoropyrimidin-2-yl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 67498621 |
| Molecular Formula | C17H25FN4O2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl 7-[[(5-fluoropyrimidin-2-yl)amino]methyl]-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC2)CC1CNc1ncc(F)cn1 |
| InChI | InChI=1S/C17H25FN4O2/c1-16(2,3)24-15(23)22-7-6-17(4-5-17)8-13(22)11-21-14-19-9-12(18)10-20-14/h9-10,13H,4-8,11H2,1-3H3,(H,19,20,21) |
| InChIKey | LVBGTMHASXCUBX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |