C16H20ClNO3 — CID 90964644
tert-butyl 2-(4-chlorophenyl)-3-methyl-5-oxopyrrolidine-1-carboxylate (PubChem CID 90964644) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is tert-butyl 2-(4-chlorophenyl)-3-methyl-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-chlorophenyl)-3-methyl-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90964644 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | tert-butyl 2-(4-chlorophenyl)-3-methyl-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC1CC(=O)N(C(=O)OC(C)(C)C)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO3/c1-10-9-13(19)18(15(20)21-16(2,3)4)14(10)11-5-7-12(17)8-6-11/h5-8,10,14H,9H2,1-4H3 |
| InChIKey | BBLDFURUZMAPPA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |