C24H31ClN2O6 — CID 23573676
ditert-butyl 8-(4-chlorophenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate (PubChem CID 23573676) has the molecular formula C24H31ClN2O6 and a molecular weight of 478.97 g/mol. Its IUPAC name is ditert-butyl 8-(4-chlorophenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate.
| Compound Name | ditert-butyl 8-(4-chlorophenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23573676 |
| Molecular Formula | C24H31ClN2O6 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ditert-butyl 8-(4-chlorophenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)N(C(=O)OC(C)(C)C)C2(CCC(c3ccc(Cl)cc3)CC2)C1=O |
| InChI | InChI=1S/C24H31ClN2O6/c1-22(2,3)32-20(30)26-18(28)24(27(19(26)29)21(31)33-23(4,5)6)13-11-16(12-14-24)15-7-9-17(25)10-8-15/h7-10,16H,11-14H2,1-6H3 |
| InChIKey | ICTRKALLJDWEJD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|