C15H18ClNO4 — CID 141120401
tert-butyl 3-(4-chlorophenyl)-3-hydroxy-2-oxopyrrolidine-1-carboxylate (PubChem CID 141120401) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is tert-butyl 3-(4-chlorophenyl)-3-hydroxy-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-chlorophenyl)-3-hydroxy-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141120401 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | tert-butyl 3-(4-chlorophenyl)-3-hydroxy-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C15H18ClNO4/c1-14(2,3)21-13(19)17-9-8-15(20,12(17)18)10-4-6-11(16)7-5-10/h4-7,20H,8-9H2,1-3H3 |
| InChIKey | NMLAEWKOUGQJHZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |