C19H29ClN2O3S — CID 71512172
tert-butyl 4-(4-chlorophenyl)-4-(propan-2-ylsulfinylamino)piperidine-1-carboxylate (PubChem CID 71512172) has the molecular formula C19H29ClN2O3S and a molecular weight of 400.97 g/mol. Its IUPAC name is tert-butyl 4-(4-chlorophenyl)-4-(propan-2-ylsulfinylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chlorophenyl)-4-(propan-2-ylsulfinylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71512172 |
| Molecular Formula | C19H29ClN2O3S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | tert-butyl 4-(4-chlorophenyl)-4-(propan-2-ylsulfinylamino)piperidine-1-carboxylate |
| SMILES | CC(C)S(=O)NC1(c2ccc(Cl)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H29ClN2O3S/c1-14(2)26(24)21-19(15-6-8-16(20)9-7-15)10-12-22(13-11-19)17(23)25-18(3,4)5/h6-9,14,21H,10-13H2,1-5H3 |
| InChIKey | HRFFQLXAUVMAAW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |