C22H27BClNO4 — CID 16658019
[4-[4-(4-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]boronic acid (PubChem CID 16658019) has the molecular formula C22H27BClNO4 and a molecular weight of 415.73 g/mol. Its IUPAC name is [4-[4-(4-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]boronic acid.
| Compound Name | [4-[4-(4-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 16658019 |
| Molecular Formula | C22H27BClNO4 |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [4-[4-(4-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(Cl)cc2)(c2ccc(B(O)O)cc2)CC1 |
| InChI | InChI=1S/C22H27BClNO4/c1-21(2,3)29-20(26)25-14-12-22(13-15-25,17-6-10-19(24)11-7-17)16-4-8-18(9-5-16)23(27)28/h4-11,27-28H,12-15H2,1-3H3 |
| InChIKey | RAEHMDSQIFTMIO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|