C17H22ClNO4 — CID 66758561
tert-butyl 4-(4-chlorophenyl)-4-methoxy-3-oxopiperidine-1-carboxylate (PubChem CID 66758561) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is tert-butyl 4-(4-chlorophenyl)-4-methoxy-3-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chlorophenyl)-4-methoxy-3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 66758561 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | tert-butyl 4-(4-chlorophenyl)-4-methoxy-3-oxopiperidine-1-carboxylate |
| SMILES | COC1(c2ccc(Cl)cc2)CCN(C(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C17H22ClNO4/c1-16(2,3)23-15(21)19-10-9-17(22-4,14(20)11-19)12-5-7-13(18)8-6-12/h5-8H,9-11H2,1-4H3 |
| InChIKey | GWMAJJBFHLPRRX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |