C12H21NO3 — CID 86276531
tert-butyl 4,4-dimethyl-3-oxopiperidine-1-carboxylate (PubChem CID 86276531) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl 4,4-dimethyl-3-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-dimethyl-3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86276531 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl 4,4-dimethyl-3-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(C)C(=O)C1 |
| InChI | InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-7-6-12(4,5)9(14)8-13/h6-8H2,1-5H3 |
| InChIKey | LIXKFZLVAXGNLL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |