C13H21N3O4 — CID 151169776
tert-butyl 1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 151169776) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is tert-butyl 1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 151169776 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | tert-butyl 1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | CN1C(=O)NC(=O)C12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C13H21N3O4/c1-12(2,3)20-11(19)16-7-5-13(6-8-16)9(17)14-10(18)15(13)4/h5-8H2,1-4H3,(H,14,17,18) |
| InChIKey | NCAKMDIQKUBHLN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|