C14H23N3O4 — CID 130597122
tert-butyl 2-methyl-3,5-dioxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate (PubChem CID 130597122) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is tert-butyl 2-methyl-3,5-dioxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 2-methyl-3,5-dioxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 130597122 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl 2-methyl-3,5-dioxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC1NC2(CCN(C(=O)OC(C)(C)C)CC2)C(=O)NC1=O |
| InChI | InChI=1S/C14H23N3O4/c1-9-10(18)15-11(19)14(16-9)5-7-17(8-6-14)12(20)21-13(2,3)4/h9,16H,5-8H2,1-4H3,(H,15,18,19) |
| InChIKey | VTIDIJPGMZTUOI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|