C13H23NO3 — CID 118230377
tert-butyl 4,4-dimethyl-5-oxoazepane-1-carboxylate (PubChem CID 118230377) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl 4,4-dimethyl-5-oxoazepane-1-carboxylate.
| Compound Name | tert-butyl 4,4-dimethyl-5-oxoazepane-1-carboxylate |
|---|---|
| PubChem CID | 118230377 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl 4,4-dimethyl-5-oxoazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C)(C)CC1 |
| InChI | InChI=1S/C13H23NO3/c1-12(2,3)17-11(16)14-8-6-10(15)13(4,5)7-9-14/h6-9H2,1-5H3 |
| InChIKey | WGXRDGDWIMGODJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |