C12H19N3O4 — CID 130941465
tert-butyl 8,10-dioxo-2,6,9-triazaspiro[4.5]decane-2-carboxylate (PubChem CID 130941465) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is tert-butyl 8,10-dioxo-2,6,9-triazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 8,10-dioxo-2,6,9-triazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 130941465 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl 8,10-dioxo-2,6,9-triazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)NCC(=O)NC2=O |
| InChI | InChI=1S/C12H19N3O4/c1-11(2,3)19-10(18)15-5-4-12(7-15)9(17)14-8(16)6-13-12/h13H,4-7H2,1-3H3,(H,14,16,17) |
| InChIKey | PRFFLHVKHAQKAB-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|