C12H20N2O3 — CID 86330800
tert-butyl (5S)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate (PubChem CID 86330800) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl (5S)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate.
| Compound Name | tert-butyl (5S)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate |
|---|---|
| PubChem CID | 86330800 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl (5S)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(CCNC2=O)C1 |
| InChI | InChI=1S/C12H20N2O3/c1-11(2,3)17-10(16)14-7-5-12(8-14)4-6-13-9(12)15/h4-8H2,1-3H3,(H,13,15)/t12-/m0/s1 |
| InChIKey | RJXAFHSMTSRJKE-LBPRGKRZSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |