C14H24N2O3 — CID 45074355
tert-butyl 1-oxo-2,8-diazaspiro[5.5]undecane-8-carboxylate (PubChem CID 45074355) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl 1-oxo-2,8-diazaspiro[5.5]undecane-8-carboxylate.
| Compound Name | tert-butyl 1-oxo-2,8-diazaspiro[5.5]undecane-8-carboxylate |
|---|---|
| PubChem CID | 45074355 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | tert-butyl 1-oxo-2,8-diazaspiro[5.5]undecane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(CCCNC2=O)C1 |
| InChI | InChI=1S/C14H24N2O3/c1-13(2,3)19-12(18)16-9-5-7-14(10-16)6-4-8-15-11(14)17/h4-10H2,1-3H3,(H,15,17) |
| InChIKey | BCWUGEIFXRKYMP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |