C13H22N2O3 — CID 86326950
tert-butyl (5R)-1-oxo-2,9-diazaspiro[4.5]decane-9-carboxylate (PubChem CID 86326950) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl (5R)-1-oxo-2,9-diazaspiro[4.5]decane-9-carboxylate.
| Compound Name | tert-butyl (5R)-1-oxo-2,9-diazaspiro[4.5]decane-9-carboxylate |
|---|---|
| PubChem CID | 86326950 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl (5R)-1-oxo-2,9-diazaspiro[4.5]decane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]2(CCNC2=O)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-12(2,3)18-11(17)15-8-4-5-13(9-15)6-7-14-10(13)16/h4-9H2,1-3H3,(H,14,16)/t13-/m1/s1 |
| InChIKey | QCRYPCJMEOXBJL-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |