C16H28N2O4 — CID 71305475
ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate (PubChem CID 71305475) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate.
| Compound Name | ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 71305475 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28N2O4/c1-12-10-17(13(19)21-15(2,3)4)8-9-18(11-12)14(20)22-16(5,6)7/h1,8-11H2,2-7H3 |
| InChIKey | GZYVFRGOAGIHKA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|