C23H26ClF3N2O2S — CID 167200248
tert-butyl 4-(4-chlorophenyl)-4-[[4-(trifluoromethyl)phenyl]sulfanylamino]piperidine-1-carboxylate (PubChem CID 167200248) has the molecular formula C23H26ClF3N2O2S and a molecular weight of 486.99 g/mol. Its IUPAC name is tert-butyl 4-(4-chlorophenyl)-4-[[4-(trifluoromethyl)phenyl]sulfanylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chlorophenyl)-4-[[4-(trifluoromethyl)phenyl]sulfanylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167200248 |
| Molecular Formula | C23H26ClF3N2O2S |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | tert-butyl 4-(4-chlorophenyl)-4-[[4-(trifluoromethyl)phenyl]sulfanylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NSc2ccc(C(F)(F)F)cc2)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H26ClF3N2O2S/c1-21(2,3)31-20(30)29-14-12-22(13-15-29,16-4-8-18(24)9-5-16)28-32-19-10-6-17(7-11-19)23(25,26)27/h4-11,28H,12-15H2,1-3H3 |
| InChIKey | UCJSJEUFCJFQPP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|