C40H52N4O10 — CID 159984219
ditert-butyl 8-(4-methoxyphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate;8-(4-methoxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 159984219) has the molecular formula C40H52N4O10 and a molecular weight of 748.87 g/mol. Its IUPAC name is ditert-butyl 8-(4-methoxyphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate;8-(4-methoxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | ditert-butyl 8-(4-methoxyphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate;8-(4-methoxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 159984219 |
| Molecular Formula | C40H52N4O10 |
| Molecular Weight | 748.87 g/mol |
| Exact Mass | 748.37 |
| IUPAC Name | ditert-butyl 8-(4-methoxyphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-1,3-dicarboxylate;8-(4-methoxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(C2CCC3(CC2)C(=O)N(C(=O)OC(C)(C)C)C(=O)N3C(=O)OC(C)(C)C)cc1.COc1ccc(C2CCC3(CC2)NC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C25H34N2O7.C15H18N2O3/c1-23(2,3)33-21(30)26-19(28)25(27(20(26)29)22(31)34-24(4,5)6)14-12-17(13-15-25)16-8-10-18(32-7)11-9-16;1-20-12-4-2-10(3-5-12)11-6-8-15(9-7-11)13(18)16-14(19)17-15/h8-11,17H,12-15H2,1-7H3;2-5,11H,6-9H2,1H3,(H2,16,17,18,19) |
| InChIKey | OGCZCCZNJPAQDX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.87 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|