C30H42N6O8 — CID 167647528
tert-butyl 2,4-dioxo-3-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate;tert-butyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 167647528) has the molecular formula C30H42N6O8 and a molecular weight of 614.70 g/mol. Its IUPAC name is tert-butyl 2,4-dioxo-3-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate;tert-butyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 2,4-dioxo-3-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate;tert-butyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 167647528 |
| Molecular Formula | C30H42N6O8 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | tert-butyl 2,4-dioxo-3-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate;tert-butyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)NC(=O)N(c1ccccc1)C2=O.CC(C)(C)OC(=O)N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C18H23N3O4.C12H19N3O4/c1-17(2,3)25-16(24)20-11-9-18(10-12-20)14(22)21(15(23)19-18)13-7-5-4-6-8-13;1-11(2,3)19-10(18)15-6-4-12(5-7-15)8(16)13-9(17)14-12/h4-8H,9-12H2,1-3H3,(H,19,23);4-7H2,1-3H3,(H2,13,14,16,17) |
| InChIKey | QCFGEPNRSDEZGH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|