C15H26N2O4 — CID 166441093
ditert-butyl (2S)-2-methyl-2,3-dihydropyrazine-1,4-dicarboxylate (PubChem CID 166441093) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is ditert-butyl (2S)-2-methyl-2,3-dihydropyrazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl (2S)-2-methyl-2,3-dihydropyrazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 166441093 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | ditert-butyl (2S)-2-methyl-2,3-dihydropyrazine-1,4-dicarboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)C=CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-11-10-16(12(18)20-14(2,3)4)8-9-17(11)13(19)21-15(5,6)7/h8-9,11H,10H2,1-7H3/t11-/m0/s1 |
| InChIKey | WVRHQZFNVWKIFX-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |