C11H17NO3 — CID 118329389
tert-butyl 2-acetyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 118329389) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is tert-butyl 2-acetyl-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-acetyl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 118329389 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | tert-butyl 2-acetyl-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(=O)C1CC=CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17NO3/c1-8(13)9-6-5-7-12(9)10(14)15-11(2,3)4/h5,7,9H,6H2,1-4H3 |
| InChIKey | JLOORMCSFCUUTQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |