C26H35NO3Si — CID 173493419
tert-butyl 2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,3-dihydropyrrole-1-carboxylate (PubChem CID 173493419) has the molecular formula C26H35NO3Si and a molecular weight of 437.66 g/mol. Its IUPAC name is tert-butyl 2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 173493419 |
| Molecular Formula | C26H35NO3Si |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | tert-butyl 2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CCC1C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H35NO3Si/c1-25(2,3)23(22-18-13-19-27(22)24(28)29-26(4,5)6)30-31(20-14-9-7-10-15-20)21-16-11-8-12-17-21/h7-17,19,22-23,31H,18H2,1-6H3 |
| InChIKey | WINPZZKIMXWEEY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|