C28H42N2O3Si — CID 173018657
tert-butyl 1,2-diamino-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1-carboxylate (PubChem CID 173018657) has the molecular formula C28H42N2O3Si and a molecular weight of 482.74 g/mol. Its IUPAC name is tert-butyl 1,2-diamino-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 1,2-diamino-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 173018657 |
| Molecular Formula | C28H42N2O3Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | tert-butyl 1,2-diamino-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(N)CCC(C(O[SiH](c2ccccc2)c2ccccc2)C(C)(C)C)CC1N |
| InChI | InChI=1S/C28H42N2O3Si/c1-26(2,3)24(20-17-18-28(30,23(29)19-20)25(31)32-27(4,5)6)33-34(21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24,34H,17-19,29-30H2,1-6H3 |
| InChIKey | UUKAHIOJIAFZFH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|