C25H37NO4Si — CID 173184420
tert-butyl N-[(3S)-4-diphenylsilyloxy-1-hydroxy-5,5-dimethylhexan-3-yl]carbamate (PubChem CID 173184420) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-diphenylsilyloxy-1-hydroxy-5,5-dimethylhexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4-diphenylsilyloxy-1-hydroxy-5,5-dimethylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 173184420 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | tert-butyl N-[(3S)-4-diphenylsilyloxy-1-hydroxy-5,5-dimethylhexan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H37NO4Si/c1-24(2,3)22(21(17-18-27)26-23(28)29-25(4,5)6)30-31(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-22,27,31H,17-18H2,1-6H3,(H,26,28)/t21-,22?/m0/s1 |
| InChIKey | PPCXBNIXIGIQKV-HMTLIYDFSA-N |
| XLogP | 3.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|